C30H44N6O7S — CID 18293455
methyl (1Z)-N-[(NZ)-N-(1-methoxypentylidene)-N'-[2-[[2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetyl]amino]ethoxy]carbamimidoyl]pentanimidate (PubChem CID 18293455) has the molecular formula C30H44N6O7S and a molecular weight of 632.78 g/mol. Its IUPAC name is methyl (1Z)-N-[(NZ)-N-(1-methoxypentylidene)-N'-[2-[[2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetyl]amino]ethoxy]carbamimidoyl]pentanimidate.
| Compound Name | methyl (1Z)-N-[(NZ)-N-(1-methoxypentylidene)-N'-[2-[[2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetyl]amino]ethoxy]carbamimidoyl]pentanimidate |
|---|---|
| PubChem CID | 18293455 |
| Molecular Formula | C30H44N6O7S |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | methyl (1Z)-N-[(NZ)-N-(1-methoxypentylidene)-N'-[2-[[2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetyl]amino]ethoxy]carbamimidoyl]pentanimidate |
| SMILES | CCCC/C(=N/C(=NOCCNC(=O)Cn1c(C)ccc(NS(=O)(=O)c2cccc(C)c2)c1=O)/N=C(/CCCC)OC)OC |
| InChI | InChI=1S/C30H44N6O7S/c1-7-9-14-27(41-5)32-30(33-28(42-6)15-10-8-2)34-43-19-18-31-26(37)21-36-23(4)16-17-25(29(36)38)35-44(39,40)24-13-11-12-22(3)20-24/h11-13,16-17,20,35H,7-10,14-15,18-19,21H2,1-6H3,(H,31,37)/b32-27-,33-28- |
| InChIKey | AAZGSBLANULWJD-KLYVQKLMSA-N |
| XLogP | 4.14 |
| TPSA | 162.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|