C10H11ClN2S — CID 22951185
3-[(6-chloro-3-pyridinyl)methyl]pyrrolidine-2-thione (PubChem CID 22951185) has the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]pyrrolidine-2-thione.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]pyrrolidine-2-thione |
|---|---|
| PubChem CID | 22951185 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]pyrrolidine-2-thione |
| SMILES | S=C1NCCC1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H11ClN2S/c11-9-2-1-7(6-13-9)5-8-3-4-12-10(8)14/h1-2,6,8H,3-5H2,(H,12,14) |
| InChIKey | AAFHBPAIEDHLMU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|