C21H29Cl2NO2S — CID 22956346
S-[4,5-dichloro-2-[(4-propylcyclohexanecarbonyl)amino]phenyl] 2,2-dimethylpropanethioate (PubChem CID 22956346) has the molecular formula C21H29Cl2NO2S and a molecular weight of 430.44 g/mol. Its IUPAC name is S-[4,5-dichloro-2-[(4-propylcyclohexanecarbonyl)amino]phenyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[4,5-dichloro-2-[(4-propylcyclohexanecarbonyl)amino]phenyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 22956346 |
| Molecular Formula | C21H29Cl2NO2S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | S-[4,5-dichloro-2-[(4-propylcyclohexanecarbonyl)amino]phenyl] 2,2-dimethylpropanethioate |
| SMILES | CCCC1CCC(C(=O)Nc2cc(Cl)c(Cl)cc2SC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H29Cl2NO2S/c1-5-6-13-7-9-14(10-8-13)19(25)24-17-11-15(22)16(23)12-18(17)27-20(26)21(2,3)4/h11-14H,5-10H2,1-4H3,(H,24,25) |
| InChIKey | WTDFWAWQUUAANR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|