C33H52O9 — CID 22957646
3-O-tert-butyl 1-O-methyl 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1,3,5-trimethyl-1-(4-methyl-2,5-dioxooxolan-3-yl)heptane-1,3,5-tricarboxylate (PubChem CID 22957646) has the molecular formula C33H52O9 and a molecular weight of 592.77 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1,3,5-trimethyl-1-(4-methyl-2,5-dioxooxolan-3-yl)heptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1,3,5-trimethyl-1-(4-methyl-2,5-dioxooxolan-3-yl)heptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 22957646 |
| Molecular Formula | C33H52O9 |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1,3,5-trimethyl-1-(4-methyl-2,5-dioxooxolan-3-yl)heptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C(=O)OC)C1C(=O)OC(=O)C1C)C(=O)OC(C)(C)C)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C33H52O9/c1-13-30(8,25(36)40-21-16-20-14-15-33(21,11)29(20,6)7)17-31(9,26(37)42-28(3,4)5)18-32(10,27(38)39-12)22-19(2)23(34)41-24(22)35/h19-22H,13-18H2,1-12H3 |
| InChIKey | YPZQQHIYCWKWON-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|