C29H46O10 — CID 22957652
3-methoxycarbonyl-1,3,5,7-tetramethyl-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]nonane-1,2,5-tricarboxylic acid (PubChem CID 22957652) has the molecular formula C29H46O10 and a molecular weight of 554.68 g/mol. Its IUPAC name is 3-methoxycarbonyl-1,3,5,7-tetramethyl-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]nonane-1,2,5-tricarboxylic acid.
| Compound Name | 3-methoxycarbonyl-1,3,5,7-tetramethyl-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]nonane-1,2,5-tricarboxylic acid |
|---|---|
| PubChem CID | 22957652 |
| Molecular Formula | C29H46O10 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | 3-methoxycarbonyl-1,3,5,7-tetramethyl-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]nonane-1,2,5-tricarboxylic acid |
| SMILES | CCC(C)(CC(C)(CC(C)(C(=O)OC)C(C(=O)O)C(C)C(=O)O)C(=O)O)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C29H46O10/c1-10-26(5,23(36)39-18-13-17-11-12-29(18,8)25(17,3)4)14-27(6,22(34)35)15-28(7,24(37)38-9)19(21(32)33)16(2)20(30)31/h16-19H,10-15H2,1-9H3,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | GRBLWGIKWKDUOP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |