C14H21N5O5 — CID 22981236
tert-butyl N-[[5-[[amino(nitramido)methylidene]amino]-2-methoxyphenyl]methyl]carbamate (PubChem CID 22981236) has the molecular formula C14H21N5O5 and a molecular weight of 339.35 g/mol. Its IUPAC name is tert-butyl N-[[5-[[amino(nitramido)methylidene]amino]-2-methoxyphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[[amino(nitramido)methylidene]amino]-2-methoxyphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 22981236 |
| Molecular Formula | C14H21N5O5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl N-[[5-[[amino(nitramido)methylidene]amino]-2-methoxyphenyl]methyl]carbamate |
| SMILES | COc1ccc(/N=C(\N)N[N+](=O)[O-])cc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21N5O5/c1-14(2,3)24-13(20)16-8-9-7-10(5-6-11(9)23-4)17-12(15)18-19(21)22/h5-7H,8H2,1-4H3,(H,16,20)(H3,15,17,18) |
| InChIKey | KCJGQUAUAIBBKH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|