C25H36O7 — CID 22982295
methyl 2-[2,5-dioxo-4-(3,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)oxolan-3-yl]-2-methyl-4-(2-methyl-5-oxooxolan-2-yl)butanoate (PubChem CID 22982295) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is methyl 2-[2,5-dioxo-4-(3,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)oxolan-3-yl]-2-methyl-4-(2-methyl-5-oxooxolan-2-yl)butanoate.
| Compound Name | methyl 2-[2,5-dioxo-4-(3,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)oxolan-3-yl]-2-methyl-4-(2-methyl-5-oxooxolan-2-yl)butanoate |
|---|---|
| PubChem CID | 22982295 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | methyl 2-[2,5-dioxo-4-(3,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)oxolan-3-yl]-2-methyl-4-(2-methyl-5-oxooxolan-2-yl)butanoate |
| SMILES | COC(=O)C(C)(CCC1(C)CCC(=O)O1)C1C(=O)OC(=O)C1C1C(C)C2CC1C(C)C2C |
| InChI | InChI=1S/C25H36O7/c1-12-13(2)16-11-15(12)14(3)18(16)19-20(22(28)31-21(19)27)25(5,23(29)30-6)10-9-24(4)8-7-17(26)32-24/h12-16,18-20H,7-11H2,1-6H3 |
| InChIKey | MALMKTALTNFJIS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|