C13H15O3P — CID 22986310
3-methyl-1-(4-methylphenyl)-5-phosphorosopentane-1,4-dione (PubChem CID 22986310) has the molecular formula C13H15O3P and a molecular weight of 250.23 g/mol. Its IUPAC name is 3-methyl-1-(4-methylphenyl)-5-phosphorosopentane-1,4-dione.
| Compound Name | 3-methyl-1-(4-methylphenyl)-5-phosphorosopentane-1,4-dione |
|---|---|
| PubChem CID | 22986310 |
| Molecular Formula | C13H15O3P |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)-5-phosphorosopentane-1,4-dione |
| SMILES | Cc1ccc(C(=O)CC(C)C(=O)CP=O)cc1 |
| InChI | InChI=1S/C13H15O3P/c1-9-3-5-11(6-4-9)12(14)7-10(2)13(15)8-17-16/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | SFNUYHJCAMHHCN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|