C19H21BrN2O2S — CID 22991960
ethyl 2-(3-benzyl-8-bromo-4,5-dihydro-3H-1,2,5-benzothiadiazepin-2-yl)acetate (PubChem CID 22991960) has the molecular formula C19H21BrN2O2S and a molecular weight of 421.36 g/mol. Its IUPAC name is ethyl 2-(3-benzyl-8-bromo-4,5-dihydro-3H-1,2,5-benzothiadiazepin-2-yl)acetate.
| Compound Name | ethyl 2-(3-benzyl-8-bromo-4,5-dihydro-3H-1,2,5-benzothiadiazepin-2-yl)acetate |
|---|---|
| PubChem CID | 22991960 |
| Molecular Formula | C19H21BrN2O2S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | ethyl 2-(3-benzyl-8-bromo-4,5-dihydro-3H-1,2,5-benzothiadiazepin-2-yl)acetate |
| SMILES | CCOC(=O)CN1Sc2cc(Br)ccc2NCC1Cc1ccccc1 |
| InChI | InChI=1S/C19H21BrN2O2S/c1-2-24-19(23)13-22-16(10-14-6-4-3-5-7-14)12-21-17-9-8-15(20)11-18(17)25-22/h3-9,11,16,21H,2,10,12-13H2,1H3 |
| InChIKey | LTBGPJDXERQINX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|