C9H9F2NO2 — CID 22993505
(1E)-1-(3,4-difluorophenyl)-1-hydroxyiminopropan-2-ol (PubChem CID 22993505) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is (1E)-1-(3,4-difluorophenyl)-1-hydroxyiminopropan-2-ol.
| Compound Name | (1E)-1-(3,4-difluorophenyl)-1-hydroxyiminopropan-2-ol |
|---|---|
| PubChem CID | 22993505 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (1E)-1-(3,4-difluorophenyl)-1-hydroxyiminopropan-2-ol |
| SMILES | CC(O)/C(=N/O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H9F2NO2/c1-5(13)9(12-14)6-2-3-7(10)8(11)4-6/h2-5,13-14H,1H3/b12-9- |
| InChIKey | DILKBKMJSCCDFA-XFXZXTDPSA-N |
| XLogP | 1.52 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|