C17H20BrN3O6S2 — CID 23002389
6-bromo-N-[2-(diethylsulfamoyl)phenyl]sulfonyl-5-methoxypyridine-2-carboxamide (PubChem CID 23002389) has the molecular formula C17H20BrN3O6S2 and a molecular weight of 506.40 g/mol. Its IUPAC name is 6-bromo-N-[2-(diethylsulfamoyl)phenyl]sulfonyl-5-methoxypyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[2-(diethylsulfamoyl)phenyl]sulfonyl-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 23002389 |
| Molecular Formula | C17H20BrN3O6S2 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.00 |
| IUPAC Name | 6-bromo-N-[2-(diethylsulfamoyl)phenyl]sulfonyl-5-methoxypyridine-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccccc1S(=O)(=O)NC(=O)c1ccc(OC)c(Br)n1 |
| InChI | InChI=1S/C17H20BrN3O6S2/c1-4-21(5-2)29(25,26)15-9-7-6-8-14(15)28(23,24)20-17(22)12-10-11-13(27-3)16(18)19-12/h6-11H,4-5H2,1-3H3,(H,20,22) |
| InChIKey | OLANGQIJYCHRIP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|