C14H10ClN5S — CID 23007758
2-amino-6-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-methylpyridine-3,5-dicarbonitrile (PubChem CID 23007758) has the molecular formula C14H10ClN5S and a molecular weight of 315.79 g/mol. Its IUPAC name is 2-amino-6-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-methylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-methylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 23007758 |
| Molecular Formula | C14H10ClN5S |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-amino-6-[(6-chloro-3-pyridinyl)methylsulfanyl]-4-methylpyridine-3,5-dicarbonitrile |
| SMILES | Cc1c(C#N)c(N)nc(SCc2ccc(Cl)nc2)c1C#N |
| InChI | InChI=1S/C14H10ClN5S/c1-8-10(4-16)13(18)20-14(11(8)5-17)21-7-9-2-3-12(15)19-6-9/h2-3,6H,7H2,1H3,(H2,18,20) |
| InChIKey | XZXOODWTKWALMS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|