About (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one
(2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one (PubChem CID 2301713) has the molecular formula C17H12BrF3N2OS
and a molecular weight of 429.26 g/mol. Its IUPAC name is (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one.
Molecular Properties
| Compound Name | (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
| PubChem CID | 2301713 |
| Molecular Formula | C17H12BrF3N2OS |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
| SMILES | C=C1S[C@](c2ccccc2)(C(F)(F)F)NC(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrF3N2OS/c1-11-23(14-9-7-13(18)8-10-14)15(24)22-16(25-11,17(19,20)21)12-5-3-2-4-6-12/h2-10H,1H2,(H,22,24)/t16-/m1/s1 |
| InChIKey | VIWJQVUMALMTIG-MRXNPFEDSA-N |
| XLogP | 5.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one?
The IUPAC name of (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one (CID 2301713) is (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one.
What is the SMILES notation for (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one?
The canonical SMILES for (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one is C=C1S[C@](c2ccccc2)(C(F)(F)F)NC(=O)N1c1ccc(Br)cc1.
What is the InChIKey of (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one?
The InChIKey is VIWJQVUMALMTIG-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H12BrF3N2OS/c1-11-23(14-9-7-13(18)8-10-14)15(24)22-16(25-11,17(19,20)21)12-5-3-2-4-6-12/h2-10H,1H2,(H,22,24)/t16-/m1/s1.
What are the key properties of (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one?
(2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one has a molecular weight of 429.26 g/mol, XLogP of 5.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-(4-bromophenyl)-6-methylidene-2-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one is sourced from PubChem (CID 2301713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).