C21H19N5O4S — CID 2303457
(3R,7E)-3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3,4,5,6-tetrahydro-1H-indazole-2-carbothioamide (PubChem CID 2303457) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is (3R,7E)-3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3,4,5,6-tetrahydro-1H-indazole-2-carbothioamide.
| Compound Name | (3R,7E)-3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3,4,5,6-tetrahydro-1H-indazole-2-carbothioamide |
|---|---|
| PubChem CID | 2303457 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (3R,7E)-3-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3,4,5,6-tetrahydro-1H-indazole-2-carbothioamide |
| SMILES | NC(=S)N1NC2=C(CCC/C2=C\c2ccc([N+](=O)[O-])cc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19N5O4S/c22-21(31)24-20(14-6-10-17(11-7-14)26(29)30)18-3-1-2-15(19(18)23-24)12-13-4-8-16(9-5-13)25(27)28/h4-12,20,23H,1-3H2,(H2,22,31)/b15-12+/t20-/m1/s1 |
| InChIKey | RQJDPEVHFGGTPE-IZLCOFNUSA-N |
| XLogP | 4.13 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|