C20H17ClO6S — CID 23038427
[5-(3-chlorophenyl)sulfinyl-4-hydroxy-2,3-dimethoxynaphthalen-1-yl] acetate (PubChem CID 23038427) has the molecular formula C20H17ClO6S and a molecular weight of 420.87 g/mol. Its IUPAC name is [5-(3-chlorophenyl)sulfinyl-4-hydroxy-2,3-dimethoxynaphthalen-1-yl] acetate.
| Compound Name | [5-(3-chlorophenyl)sulfinyl-4-hydroxy-2,3-dimethoxynaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 23038427 |
| Molecular Formula | C20H17ClO6S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | [5-(3-chlorophenyl)sulfinyl-4-hydroxy-2,3-dimethoxynaphthalen-1-yl] acetate |
| SMILES | COc1c(OC)c(O)c2c(S(=O)c3cccc(Cl)c3)cccc2c1OC(C)=O |
| InChI | InChI=1S/C20H17ClO6S/c1-11(22)27-18-14-8-5-9-15(28(24)13-7-4-6-12(21)10-13)16(14)17(23)19(25-2)20(18)26-3/h4-10,23H,1-3H3 |
| InChIKey | GMCNSHBLMIOLNP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|