C22H26N2O6S — CID 23038316
[5-(1H-imidazol-2-ylsulfinyl)-2,3-dimethoxy-4-pentoxynaphthalen-1-yl] acetate (PubChem CID 23038316) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is [5-(1H-imidazol-2-ylsulfinyl)-2,3-dimethoxy-4-pentoxynaphthalen-1-yl] acetate.
| Compound Name | [5-(1H-imidazol-2-ylsulfinyl)-2,3-dimethoxy-4-pentoxynaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 23038316 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [5-(1H-imidazol-2-ylsulfinyl)-2,3-dimethoxy-4-pentoxynaphthalen-1-yl] acetate |
| SMILES | CCCCCOc1c(OC)c(OC)c(OC(C)=O)c2cccc(S(=O)c3ncc[nH]3)c12 |
| InChI | InChI=1S/C22H26N2O6S/c1-5-6-7-13-29-19-17-15(18(30-14(2)25)20(27-3)21(19)28-4)9-8-10-16(17)31(26)22-23-11-12-24-22/h8-12H,5-7,13H2,1-4H3,(H,23,24) |
| InChIKey | MPPAYIRVTIKZBK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|