C31H39NO6S — CID 23319815
(4-acetyloxy-2,3-dihexoxy-6-pyridin-4-ylsulfanylnaphthalen-1-yl) acetate (PubChem CID 23319815) has the molecular formula C31H39NO6S and a molecular weight of 553.72 g/mol. Its IUPAC name is (4-acetyloxy-2,3-dihexoxy-6-pyridin-4-ylsulfanylnaphthalen-1-yl) acetate.
| Compound Name | (4-acetyloxy-2,3-dihexoxy-6-pyridin-4-ylsulfanylnaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 23319815 |
| Molecular Formula | C31H39NO6S |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | (4-acetyloxy-2,3-dihexoxy-6-pyridin-4-ylsulfanylnaphthalen-1-yl) acetate |
| SMILES | CCCCCCOc1c(OCCCCCC)c(OC(C)=O)c2cc(Sc3ccncc3)ccc2c1OC(C)=O |
| InChI | InChI=1S/C31H39NO6S/c1-5-7-9-11-19-35-30-28(37-22(3)33)26-14-13-25(39-24-15-17-32-18-16-24)21-27(26)29(38-23(4)34)31(30)36-20-12-10-8-6-2/h13-18,21H,5-12,19-20H2,1-4H3 |
| InChIKey | VXIZPIBXXGWZCM-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|