C7H10Cl3F3O — CID 23044768
1,1,1-trifluoro-4-(1,3,3-trichloropropoxy)butane (PubChem CID 23044768) has the molecular formula C7H10Cl3F3O and a molecular weight of 273.51 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(1,3,3-trichloropropoxy)butane.
| Compound Name | 1,1,1-trifluoro-4-(1,3,3-trichloropropoxy)butane |
|---|---|
| PubChem CID | 23044768 |
| Molecular Formula | C7H10Cl3F3O |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 1,1,1-trifluoro-4-(1,3,3-trichloropropoxy)butane |
| SMILES | FC(F)(F)CCCOC(Cl)CC(Cl)Cl |
| InChI | InChI=1S/C7H10Cl3F3O/c8-5(9)4-6(10)14-3-1-2-7(11,12)13/h5-6H,1-4H2 |
| InChIKey | GNHOOBMWCJWBFT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|