About di(butan-2-yloxy)borinic acid
di(butan-2-yloxy)borinic acid (PubChem CID 23050927) has the molecular formula C8H19BO3
and a molecular weight of 174.05 g/mol. Its IUPAC name is di(butan-2-yloxy)borinic acid.
Molecular Properties
| Compound Name | di(butan-2-yloxy)borinic acid |
| PubChem CID | 23050927 |
| Molecular Formula | C8H19BO3 |
| Molecular Weight | 174.05 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | di(butan-2-yloxy)borinic acid |
| SMILES | CCC(C)OB(O)OC(C)CC |
| InChI | InChI=1S/C8H19BO3/c1-5-7(3)11-9(10)12-8(4)6-2/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | CBDHDQAONYJJIJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.05 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(butan-2-yloxy)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(butan-2-yloxy)borinic acid?
The IUPAC name of di(butan-2-yloxy)borinic acid (CID 23050927) is di(butan-2-yloxy)borinic acid.
What is the SMILES notation for di(butan-2-yloxy)borinic acid?
The canonical SMILES for di(butan-2-yloxy)borinic acid is CCC(C)OB(O)OC(C)CC.
What is the InChIKey of di(butan-2-yloxy)borinic acid?
The InChIKey is CBDHDQAONYJJIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19BO3/c1-5-7(3)11-9(10)12-8(4)6-2/h7-8,10H,5-6H2,1-4H3.
What are the key properties of di(butan-2-yloxy)borinic acid?
di(butan-2-yloxy)borinic acid has a molecular weight of 174.05 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for di(butan-2-yloxy)borinic acid is sourced from PubChem (CID 23050927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).