C12H9N3O — CID 2305838
N-pyridin-2-yl-1,3-benzoxazol-2-amine (PubChem CID 2305838) has the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. Its IUPAC name is N-pyridin-2-yl-1,3-benzoxazol-2-amine.
| Compound Name | N-pyridin-2-yl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 2305838 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | N-pyridin-2-yl-1,3-benzoxazol-2-amine |
| SMILES | c1ccc(Nc2nc3ccccc3o2)nc1 |
| InChI | InChI=1S/C12H9N3O/c1-2-6-10-9(5-1)14-12(16-10)15-11-7-3-4-8-13-11/h1-8H,(H,13,14,15) |
| InChIKey | YMRWEBLZMFGRTH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |