C15H22N2O2 — CID 2306545
ethyl N-[1-(4-tert-butylphenyl)ethenylamino]carbamate (PubChem CID 2306545) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethyl N-[1-(4-tert-butylphenyl)ethenylamino]carbamate.
| Compound Name | ethyl N-[1-(4-tert-butylphenyl)ethenylamino]carbamate |
|---|---|
| PubChem CID | 2306545 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | ethyl N-[1-(4-tert-butylphenyl)ethenylamino]carbamate |
| SMILES | C=C(NNC(=O)OCC)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22N2O2/c1-6-19-14(18)17-16-11(2)12-7-9-13(10-8-12)15(3,4)5/h7-10,16H,2,6H2,1,3-5H3,(H,17,18) |
| InChIKey | JDTORYVWBOFJLW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|