C16H28N2+2 — CID 2308083
1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylcyclohex-2-en-1-ylidene)pyrrolidin-1-ium (PubChem CID 2308083) has the molecular formula C16H28N2+2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylcyclohex-2-en-1-ylidene)pyrrolidin-1-ium.
| Compound Name | 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylcyclohex-2-en-1-ylidene)pyrrolidin-1-ium |
|---|---|
| PubChem CID | 2308083 |
| Molecular Formula | C16H28N2+2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.22 |
| IUPAC Name | 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylcyclohex-2-en-1-ylidene)pyrrolidin-1-ium |
| SMILES | CC1(C)CC([NH+]2CCCC2)=CC(=[N+]2CCCC2)C1 |
| InChI | InChI=1S/C16H27N2/c1-16(2)12-14(17-7-3-4-8-17)11-15(13-16)18-9-5-6-10-18/h11H,3-10,12-13H2,1-2H3/q+1/p+1 |
| InChIKey | JHLURTREAGIFPK-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 7.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|