About CID 23094248
CID 23094248 (PubChem CID 23094248) has the molecular formula C8H15O3Si
and a molecular weight of 187.29 g/mol.
Molecular Properties
| Compound Name | CID 23094248 |
| PubChem CID | 23094248 |
| Molecular Formula | C8H15O3Si |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCCC[Si](C)O |
| InChI | InChI=1S/C8H15O3Si/c1-7(2)8(9)11-5-4-6-12(3)10/h10H,1,4-6H2,2-3H3 |
| InChIKey | BXQRQEQEUXWJLN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 23094248 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23094248?
The IUPAC name of CID 23094248 (CID 23094248) is not available.
What is the SMILES notation for CID 23094248?
The canonical SMILES for CID 23094248 is C=C(C)C(=O)OCCC[Si](C)O.
What is the InChIKey of CID 23094248?
The InChIKey is BXQRQEQEUXWJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O3Si/c1-7(2)8(9)11-5-4-6-12(3)10/h10H,1,4-6H2,2-3H3.
What are the key properties of CID 23094248?
CID 23094248 has a molecular weight of 187.29 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23094248 is sourced from PubChem (CID 23094248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).