C26H20N2O6S — CID 23098835
methyl 4-[2,5-dioxo-3-[4-[(3-oxo-1H-2-benzofuran-1-yl)amino]phenyl]sulfanylpyrrolidin-1-yl]benzoate (PubChem CID 23098835) has the molecular formula C26H20N2O6S and a molecular weight of 488.52 g/mol. Its IUPAC name is methyl 4-[2,5-dioxo-3-[4-[(3-oxo-1H-2-benzofuran-1-yl)amino]phenyl]sulfanylpyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[2,5-dioxo-3-[4-[(3-oxo-1H-2-benzofuran-1-yl)amino]phenyl]sulfanylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23098835 |
| Molecular Formula | C26H20N2O6S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | methyl 4-[2,5-dioxo-3-[4-[(3-oxo-1H-2-benzofuran-1-yl)amino]phenyl]sulfanylpyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC4OC(=O)c5ccccc54)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H20N2O6S/c1-33-25(31)15-6-10-17(11-7-15)28-22(29)14-21(24(28)30)35-18-12-8-16(9-13-18)27-23-19-4-2-3-5-20(19)26(32)34-23/h2-13,21,23,27H,14H2,1H3 |
| InChIKey | HJLAXKGICXJOJM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|