C20H12BrClN4O2S — CID 23102135
2-[anilino-[1-(4-bromo-2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylmethylidene]propanedinitrile (PubChem CID 23102135) has the molecular formula C20H12BrClN4O2S and a molecular weight of 487.77 g/mol. Its IUPAC name is 2-[anilino-[1-(4-bromo-2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylmethylidene]propanedinitrile.
| Compound Name | 2-[anilino-[1-(4-bromo-2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylmethylidene]propanedinitrile |
|---|---|
| PubChem CID | 23102135 |
| Molecular Formula | C20H12BrClN4O2S |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | 2-[anilino-[1-(4-bromo-2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylmethylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C(Nc1ccccc1)SC1CC(=O)N(c2ccc(Br)cc2Cl)C1=O |
| InChI | InChI=1S/C20H12BrClN4O2S/c21-13-6-7-16(15(22)8-13)26-18(27)9-17(20(26)28)29-19(12(10-23)11-24)25-14-4-2-1-3-5-14/h1-8,17,25H,9H2 |
| InChIKey | DYADATLDPFFPTC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|