About [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate
[3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate (PubChem CID 23109671) has the molecular formula C15H12FN3O2S
and a molecular weight of 317.35 g/mol. Its IUPAC name is [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate.
Molecular Properties
| Compound Name | [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate |
| PubChem CID | 23109671 |
| Molecular Formula | C15H12FN3O2S |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate |
| SMILES | Cc1cc(-c2ccc(F)cc2)nc2sc(OC(N)=O)c(N)c12 |
| InChI | InChI=1S/C15H12FN3O2S/c1-7-6-10(8-2-4-9(16)5-3-8)19-13-11(7)12(17)14(22-13)21-15(18)20/h2-6H,17H2,1H3,(H2,18,20) |
| InChIKey | SHCHCJSATBJFHZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate?
The IUPAC name of [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate (CID 23109671) is [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate.
What is the SMILES notation for [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate?
The canonical SMILES for [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate is Cc1cc(-c2ccc(F)cc2)nc2sc(OC(N)=O)c(N)c12.
What is the InChIKey of [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate?
The InChIKey is SHCHCJSATBJFHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O2S/c1-7-6-10(8-2-4-9(16)5-3-8)19-13-11(7)12(17)14(22-13)21-15(18)20/h2-6H,17H2,1H3,(H2,18,20).
What are the key properties of [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate?
[3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate has a molecular weight of 317.35 g/mol, XLogP of 3.45, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-6-(4-fluorophenyl)-4-methylthieno[2,3-b]pyridin-2-yl] carbamate is sourced from PubChem (CID 23109671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).