C25H21F2N3O3 — CID 23121884
N-(2,4-difluorophenyl)-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide (PubChem CID 23121884) has the molecular formula C25H21F2N3O3 and a molecular weight of 449.46 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23121884 |
| Molecular Formula | C25H21F2N3O3 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)N1CCN2C(=O)OC(c3ccccc3)(c3ccccc3)C2C1 |
| InChI | InChI=1S/C25H21F2N3O3/c26-19-11-12-21(20(27)15-19)28-23(31)29-13-14-30-22(16-29)25(33-24(30)32,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-12,15,22H,13-14,16H2,(H,28,31) |
| InChIKey | FXBVEZMZSGHYEJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |