C26H22F3N3O3 — CID 23121950
1,1-bis(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-3-oxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide (PubChem CID 23121950) has the molecular formula C26H22F3N3O3 and a molecular weight of 481.47 g/mol. Its IUPAC name is 1,1-bis(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-3-oxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide.
| Compound Name | 1,1-bis(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-3-oxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23121950 |
| Molecular Formula | C26H22F3N3O3 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1,1-bis(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-3-oxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CCN2C(=O)OC(c3ccc(F)cc3)(c3ccc(F)cc3)C2C1 |
| InChI | InChI=1S/C26H22F3N3O3/c27-20-7-1-17(2-8-20)15-30-24(33)31-13-14-32-23(16-31)26(35-25(32)34,18-3-9-21(28)10-4-18)19-5-11-22(29)12-6-19/h1-12,23H,13-16H2,(H,30,33) |
| InChIKey | LGSYAIYFYUIUEA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |