C25H33F2N3O3 — CID 23122009
1,1-dicyclohexyl-N-(2,4-difluorophenyl)-3-oxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide (PubChem CID 23122009) has the molecular formula C25H33F2N3O3 and a molecular weight of 461.55 g/mol. Its IUPAC name is 1,1-dicyclohexyl-N-(2,4-difluorophenyl)-3-oxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide.
| Compound Name | 1,1-dicyclohexyl-N-(2,4-difluorophenyl)-3-oxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23122009 |
| Molecular Formula | C25H33F2N3O3 |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 1,1-dicyclohexyl-N-(2,4-difluorophenyl)-3-oxo-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)N1CCN2C(=O)OC(C3CCCCC3)(C3CCCCC3)C2C1 |
| InChI | InChI=1S/C25H33F2N3O3/c26-19-11-12-21(20(27)15-19)28-23(31)29-13-14-30-22(16-29)25(33-24(30)32,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h11-12,15,17-18,22H,1-10,13-14,16H2,(H,28,31) |
| InChIKey | NTDCKMIEJSNDBV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |