C13H24F5N — CID 23123210
5-ethyl-2-methyl-N-(1,1,2,2,2-pentafluoroethyl)octan-1-amine (PubChem CID 23123210) has the molecular formula C13H24F5N and a molecular weight of 289.33 g/mol. Its IUPAC name is 5-ethyl-2-methyl-N-(1,1,2,2,2-pentafluoroethyl)octan-1-amine.
| Compound Name | 5-ethyl-2-methyl-N-(1,1,2,2,2-pentafluoroethyl)octan-1-amine |
|---|---|
| PubChem CID | 23123210 |
| Molecular Formula | C13H24F5N |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 5-ethyl-2-methyl-N-(1,1,2,2,2-pentafluoroethyl)octan-1-amine |
| SMILES | CCCC(CC)CCC(C)CNC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H24F5N/c1-4-6-11(5-2)8-7-10(3)9-19-13(17,18)12(14,15)16/h10-11,19H,4-9H2,1-3H3 |
| InChIKey | VFLWQGPMAKQLHK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|