About 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one
5-benzoyl-2-phenyl-3,1-benzoxazin-4-one (PubChem CID 23126063) has the molecular formula C21H13NO3
and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one |
| PubChem CID | 23126063 |
| Molecular Formula | C21H13NO3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one |
| SMILES | O=C(c1ccccc1)c1cccc2nc(-c3ccccc3)oc(=O)c12 |
| InChI | InChI=1S/C21H13NO3/c23-19(14-8-3-1-4-9-14)16-12-7-13-17-18(16)21(24)25-20(22-17)15-10-5-2-6-11-15/h1-13H |
| InChIKey | PTOBKDFBDYEJDF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one?
The IUPAC name of 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one (CID 23126063) is 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one.
What is the SMILES notation for 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one?
The canonical SMILES for 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one is O=C(c1ccccc1)c1cccc2nc(-c3ccccc3)oc(=O)c12.
What is the InChIKey of 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one?
The InChIKey is PTOBKDFBDYEJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13NO3/c23-19(14-8-3-1-4-9-14)16-12-7-13-17-18(16)21(24)25-20(22-17)15-10-5-2-6-11-15/h1-13H.
What are the key properties of 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one?
5-benzoyl-2-phenyl-3,1-benzoxazin-4-one has a molecular weight of 327.34 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzoyl-2-phenyl-3,1-benzoxazin-4-one is sourced from PubChem (CID 23126063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).