C32H66O3P+ — CID 23131996
bis(5,8-diethyldodecan-6-yloxy)-oxophosphanium (PubChem CID 23131996) has the molecular formula C32H66O3P+ and a molecular weight of 529.85 g/mol. Its IUPAC name is bis(5,8-diethyldodecan-6-yloxy)-oxophosphanium.
| Compound Name | bis(5,8-diethyldodecan-6-yloxy)-oxophosphanium |
|---|---|
| PubChem CID | 23131996 |
| Molecular Formula | C32H66O3P+ |
| Molecular Weight | 529.85 g/mol |
| Exact Mass | 529.47 |
| IUPAC Name | bis(5,8-diethyldodecan-6-yloxy)-oxophosphanium |
| SMILES | CCCCC(CC)CC(O[P+](=O)OC(CC(CC)CCCC)C(CC)CCCC)C(CC)CCCC |
| InChI | InChI=1S/C32H66O3P/c1-9-17-21-27(13-5)25-31(29(15-7)23-19-11-3)34-36(33)35-32(30(16-8)24-20-12-4)26-28(14-6)22-18-10-2/h27-32H,9-26H2,1-8H3/q+1 |
| InChIKey | QXQXBBOTWWLFII-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.85 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|