C17H37O4P — CID 88750018
5,8-diethyldodecan-6-yloxy(hydroxymethyl)phosphinic acid (PubChem CID 88750018) has the molecular formula C17H37O4P and a molecular weight of 336.45 g/mol. Its IUPAC name is 5,8-diethyldodecan-6-yloxy(hydroxymethyl)phosphinic acid.
| Compound Name | 5,8-diethyldodecan-6-yloxy(hydroxymethyl)phosphinic acid |
|---|---|
| PubChem CID | 88750018 |
| Molecular Formula | C17H37O4P |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 5,8-diethyldodecan-6-yloxy(hydroxymethyl)phosphinic acid |
| SMILES | CCCCC(CC)CC(OP(=O)(O)CO)C(CC)CCCC |
| InChI | InChI=1S/C17H37O4P/c1-5-9-11-15(7-3)13-17(21-22(19,20)14-18)16(8-4)12-10-6-2/h15-18H,5-14H2,1-4H3,(H,19,20) |
| InChIKey | KOYVKUZYZBLYLB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|