C16H35O3P — CID 21249648
5,8-diethyldodecan-6-yl dihydrogen phosphite (PubChem CID 21249648) has the molecular formula C16H35O3P and a molecular weight of 306.43 g/mol. Its IUPAC name is 5,8-diethyldodecan-6-yl dihydrogen phosphite.
| Compound Name | 5,8-diethyldodecan-6-yl dihydrogen phosphite |
|---|---|
| PubChem CID | 21249648 |
| Molecular Formula | C16H35O3P |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 5,8-diethyldodecan-6-yl dihydrogen phosphite |
| SMILES | CCCCC(CC)CC(OP(O)O)C(CC)CCCC |
| InChI | InChI=1S/C16H35O3P/c1-5-9-11-14(7-3)13-16(19-20(17)18)15(8-4)12-10-6-2/h14-18H,5-13H2,1-4H3 |
| InChIKey | QBCVMQLDWGGBFQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|