About dibromo-(2,6-difluorophenyl)phosphane
dibromo-(2,6-difluorophenyl)phosphane (PubChem CID 23135564) has the molecular formula C6H3Br2F2P
and a molecular weight of 303.87 g/mol. Its IUPAC name is dibromo-(2,6-difluorophenyl)phosphane.
Molecular Properties
| Compound Name | dibromo-(2,6-difluorophenyl)phosphane |
| PubChem CID | 23135564 |
| Molecular Formula | C6H3Br2F2P |
| Molecular Weight | 303.87 g/mol |
| Exact Mass | 301.83 |
| IUPAC Name | dibromo-(2,6-difluorophenyl)phosphane |
| SMILES | Fc1cccc(F)c1P(Br)Br |
| InChI | InChI=1S/C6H3Br2F2P/c7-11(8)6-4(9)2-1-3-5(6)10/h1-3H |
| InChIKey | SQDBLHMXTGUEHW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibromo-(2,6-difluorophenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromo-(2,6-difluorophenyl)phosphane?
The IUPAC name of dibromo-(2,6-difluorophenyl)phosphane (CID 23135564) is dibromo-(2,6-difluorophenyl)phosphane.
What is the SMILES notation for dibromo-(2,6-difluorophenyl)phosphane?
The canonical SMILES for dibromo-(2,6-difluorophenyl)phosphane is Fc1cccc(F)c1P(Br)Br.
What is the InChIKey of dibromo-(2,6-difluorophenyl)phosphane?
The InChIKey is SQDBLHMXTGUEHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br2F2P/c7-11(8)6-4(9)2-1-3-5(6)10/h1-3H.
What are the key properties of dibromo-(2,6-difluorophenyl)phosphane?
dibromo-(2,6-difluorophenyl)phosphane has a molecular weight of 303.87 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromo-(2,6-difluorophenyl)phosphane is sourced from PubChem (CID 23135564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).