About (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate
(4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate (PubChem CID 23146186) has the molecular formula C17H20N2O6
and a molecular weight of 348.36 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate |
| PubChem CID | 23146186 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate |
| SMILES | CCC(C)OC(=O)CNCC#CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N2O6/c1-3-13(2)25-17(21)11-18-10-4-5-16(20)24-12-14-6-8-15(9-7-14)19(22)23/h6-9,13,18H,3,10-12H2,1-2H3 |
| InChIKey | SVUQPOZSPACGPS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate?
The IUPAC name of (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate (CID 23146186) is (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate.
What is the SMILES notation for (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate?
The canonical SMILES for (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate is CCC(C)OC(=O)CNCC#CC(=O)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate?
The InChIKey is SVUQPOZSPACGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O6/c1-3-13(2)25-17(21)11-18-10-4-5-16(20)24-12-14-6-8-15(9-7-14)19(22)23/h6-9,13,18H,3,10-12H2,1-2H3.
What are the key properties of (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate?
(4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate has a molecular weight of 348.36 g/mol, XLogP of 1.57, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl 4-[(2-butan-2-yloxy-2-oxoethyl)amino]but-2-ynoate is sourced from PubChem (CID 23146186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).