About (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate
(4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate (PubChem CID 71366688) has the molecular formula C18H15NO5
and a molecular weight of 325.32 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate |
| PubChem CID | 71366688 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate |
| SMILES | O=C(C#CCOCc1ccccc1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15NO5/c20-18(7-4-12-23-13-15-5-2-1-3-6-15)24-14-16-8-10-17(11-9-16)19(21)22/h1-3,5-6,8-11H,12-14H2 |
| InChIKey | UBFHGIIMKBNXEL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate?
The IUPAC name of (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate (CID 71366688) is (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate.
What is the SMILES notation for (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate?
The canonical SMILES for (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate is O=C(C#CCOCc1ccccc1)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate?
The InChIKey is UBFHGIIMKBNXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5/c20-18(7-4-12-23-13-15-5-2-1-3-6-15)24-14-16-8-10-17(11-9-16)19(21)22/h1-3,5-6,8-11H,12-14H2.
What are the key properties of (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate?
(4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate has a molecular weight of 325.32 g/mol, XLogP of 2.86, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl 4-phenylmethoxybut-2-ynoate is sourced from PubChem (CID 71366688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).