C22H27N5OS2 — CID 23155887
2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23155887) has the molecular formula C22H27N5OS2 and a molecular weight of 441.63 g/mol. Its IUPAC name is 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23155887 |
| Molecular Formula | C22H27N5OS2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(SCCCN2CCN(c3ccccn3)CC2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C22H27N5OS2/c28-20-19-16-6-1-2-7-17(16)30-21(19)25-22(24-20)29-15-5-10-26-11-13-27(14-12-26)18-8-3-4-9-23-18/h3-4,8-9H,1-2,5-7,10-15H2,(H,24,25,28) |
| InChIKey | MSESHVBBGQBTCY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|