C19H24N6OS2 — CID 68742816
6-amino-5-methyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 68742816) has the molecular formula C19H24N6OS2 and a molecular weight of 416.58 g/mol. Its IUPAC name is 6-amino-5-methyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-amino-5-methyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 68742816 |
| Molecular Formula | C19H24N6OS2 |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 6-amino-5-methyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1c(N)sc2nc(SCCCN3CCN(c4ccccn4)CC3)[nH]c(=O)c12 |
| InChI | InChI=1S/C19H24N6OS2/c1-13-15-17(26)22-19(23-18(15)28-16(13)20)27-12-4-7-24-8-10-25(11-9-24)14-5-2-3-6-21-14/h2-3,5-6H,4,7-12,20H2,1H3,(H,22,23,26) |
| InChIKey | JUJWEHCUFXLCGI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|