C23H21ClFN7OS — CID 23158993
2-(5-azidopentyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 23158993) has the molecular formula C23H21ClFN7OS and a molecular weight of 497.99 g/mol. Its IUPAC name is 2-(5-azidopentyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
| Compound Name | 2-(5-azidopentyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 23158993 |
| Molecular Formula | C23H21ClFN7OS |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-(5-azidopentyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | [N-]=[N+]=NCCCCCc1nc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2s1 |
| InChI | InChI=1S/C23H21ClFN7OS/c24-18-12-17(8-9-19(18)33-13-15-5-4-6-16(25)11-15)30-22-21-23(28-14-27-22)34-20(31-21)7-2-1-3-10-29-32-26/h4-6,8-9,11-12,14H,1-3,7,10,13H2,(H,27,28,30) |
| InChIKey | MSEPMNQQFPNBRQ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|