C16H32NO+ — CID 23167553
4-cyclodecyl-2,6-dimethylmorpholin-4-ium (PubChem CID 23167553) has the molecular formula C16H32NO+ and a molecular weight of 254.44 g/mol. Its IUPAC name is 4-cyclodecyl-2,6-dimethylmorpholin-4-ium.
| Compound Name | 4-cyclodecyl-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 23167553 |
| Molecular Formula | C16H32NO+ |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 4-cyclodecyl-2,6-dimethylmorpholin-4-ium |
| SMILES | CC1C[NH+](C2CCCCCCCCC2)CC(C)O1 |
| InChI | InChI=1S/C16H31NO/c1-14-12-17(13-15(2)18-14)16-10-8-6-4-3-5-7-9-11-16/h14-16H,3-13H2,1-2H3/p+1 |
| InChIKey | AQDMDSZWPQNPOG-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |