C24H28FNOSSi — CID 23171302
(6-ethylsulfanyl-3-pyridinyl)-[3-(4-fluoro-3-phenoxyphenyl)propyl]-dimethylsilane (PubChem CID 23171302) has the molecular formula C24H28FNOSSi and a molecular weight of 425.65 g/mol. Its IUPAC name is (6-ethylsulfanyl-3-pyridinyl)-[3-(4-fluoro-3-phenoxyphenyl)propyl]-dimethylsilane.
| Compound Name | (6-ethylsulfanyl-3-pyridinyl)-[3-(4-fluoro-3-phenoxyphenyl)propyl]-dimethylsilane |
|---|---|
| PubChem CID | 23171302 |
| Molecular Formula | C24H28FNOSSi |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (6-ethylsulfanyl-3-pyridinyl)-[3-(4-fluoro-3-phenoxyphenyl)propyl]-dimethylsilane |
| SMILES | CCSc1ccc([Si](C)(C)CCCc2ccc(F)c(Oc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C24H28FNOSSi/c1-4-28-24-15-13-21(18-26-24)29(2,3)16-8-9-19-12-14-22(25)23(17-19)27-20-10-6-5-7-11-20/h5-7,10-15,17-18H,4,8-9,16H2,1-3H3 |
| InChIKey | ULTXUAJOTJDKTH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|