C17H14Cl2F2N2O4 — CID 23204555
N-(3,5-dichloro-2,6-difluoro-4-pyridinyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide (PubChem CID 23204555) has the molecular formula C17H14Cl2F2N2O4 and a molecular weight of 419.21 g/mol. Its IUPAC name is N-(3,5-dichloro-2,6-difluoro-4-pyridinyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide.
| Compound Name | N-(3,5-dichloro-2,6-difluoro-4-pyridinyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide |
|---|---|
| PubChem CID | 23204555 |
| Molecular Formula | C17H14Cl2F2N2O4 |
| Molecular Weight | 419.21 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N-(3,5-dichloro-2,6-difluoro-4-pyridinyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)c(F)nc(F)c2Cl)cc1OC1CCOC1 |
| InChI | InChI=1S/C17H14Cl2F2N2O4/c1-25-10-3-2-8(6-11(10)27-9-4-5-26-7-9)17(24)22-14-12(18)15(20)23-16(21)13(14)19/h2-3,6,9H,4-5,7H2,1H3,(H,22,23,24) |
| InChIKey | LSQNLWXMPLFKRO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|