C19H18Cl2N2O5 — CID 23204628
3,5-dichloro-4-[[4-methoxy-3-(oxolan-3-yloxy)benzoyl]amino]benzamide (PubChem CID 23204628) has the molecular formula C19H18Cl2N2O5 and a molecular weight of 425.27 g/mol. Its IUPAC name is 3,5-dichloro-4-[[4-methoxy-3-(oxolan-3-yloxy)benzoyl]amino]benzamide.
| Compound Name | 3,5-dichloro-4-[[4-methoxy-3-(oxolan-3-yloxy)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 23204628 |
| Molecular Formula | C19H18Cl2N2O5 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 3,5-dichloro-4-[[4-methoxy-3-(oxolan-3-yloxy)benzoyl]amino]benzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cc(C(N)=O)cc2Cl)cc1OC1CCOC1 |
| InChI | InChI=1S/C19H18Cl2N2O5/c1-26-15-3-2-10(8-16(15)28-12-4-5-27-9-12)19(25)23-17-13(20)6-11(18(22)24)7-14(17)21/h2-3,6-8,12H,4-5,9H2,1H3,(H2,22,24)(H,23,25) |
| InChIKey | IJKXUQMVNVGMEN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |