C16H15Cl2N3O6 — CID 135515535
N-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-5-methoxy-1-oxido-4-(oxolan-3-yloxy)pyridin-1-ium-2-carboxamide (PubChem CID 135515535) has the molecular formula C16H15Cl2N3O6 and a molecular weight of 416.22 g/mol. Its IUPAC name is N-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-5-methoxy-1-oxido-4-(oxolan-3-yloxy)pyridin-1-ium-2-carboxamide.
| Compound Name | N-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-5-methoxy-1-oxido-4-(oxolan-3-yloxy)pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135515535 |
| Molecular Formula | C16H15Cl2N3O6 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-5-methoxy-1-oxido-4-(oxolan-3-yloxy)pyridin-1-ium-2-carboxamide |
| SMILES | COc1c[n+]([O-])c(C(=O)Nc2c(Cl)c[n+]([O-])cc2Cl)cc1OC1CCOC1 |
| InChI | InChI=1S/C16H15Cl2N3O6/c1-25-14-7-21(24)12(4-13(14)27-9-2-3-26-8-9)16(22)19-15-10(17)5-20(23)6-11(15)18/h4-7,9H,2-3,8H2,1H3,(H,19,22) |
| InChIKey | RLGKEMYHHGGAJP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|