C19H19Cl2NO5 — CID 23204629
N-(2,6-dichloro-4-methoxyphenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide (PubChem CID 23204629) has the molecular formula C19H19Cl2NO5 and a molecular weight of 412.27 g/mol. Its IUPAC name is N-(2,6-dichloro-4-methoxyphenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide.
| Compound Name | N-(2,6-dichloro-4-methoxyphenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide |
|---|---|
| PubChem CID | 23204629 |
| Molecular Formula | C19H19Cl2NO5 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-(2,6-dichloro-4-methoxyphenyl)-4-methoxy-3-(oxolan-3-yloxy)benzamide |
| SMILES | COc1cc(Cl)c(NC(=O)c2ccc(OC)c(OC3CCOC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO5/c1-24-13-8-14(20)18(15(21)9-13)22-19(23)11-3-4-16(25-2)17(7-11)27-12-5-6-26-10-12/h3-4,7-9,12H,5-6,10H2,1-2H3,(H,22,23) |
| InChIKey | PAIDHQJKICTSNU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |