C17H16Cl2N2O5 — CID 56992250
2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[5-methoxy-4-(oxolan-3-yloxy)-2-pyridinyl]ethanone (PubChem CID 56992250) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[5-methoxy-4-(oxolan-3-yloxy)-2-pyridinyl]ethanone.
| Compound Name | 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[5-methoxy-4-(oxolan-3-yloxy)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 56992250 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[5-methoxy-4-(oxolan-3-yloxy)-2-pyridinyl]ethanone |
| SMILES | COc1cnc(C(=O)Cc2c(Cl)c[n+]([O-])cc2Cl)cc1OC1CCOC1 |
| InChI | InChI=1S/C17H16Cl2N2O5/c1-24-17-6-20-14(5-16(17)26-10-2-3-25-9-10)15(22)4-11-12(18)7-21(23)8-13(11)19/h5-8,10H,2-4,9H2,1H3 |
| InChIKey | PXYGEHZWDIWNKJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|