C16H14F3NO4S — CID 23212702
(4-methyl-6-oxo-2-phenyl-3-prop-2-enyl-1-pyridinyl) trifluoromethanesulfonate (PubChem CID 23212702) has the molecular formula C16H14F3NO4S and a molecular weight of 373.35 g/mol. Its IUPAC name is (4-methyl-6-oxo-2-phenyl-3-prop-2-enyl-1-pyridinyl) trifluoromethanesulfonate.
| Compound Name | (4-methyl-6-oxo-2-phenyl-3-prop-2-enyl-1-pyridinyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23212702 |
| Molecular Formula | C16H14F3NO4S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (4-methyl-6-oxo-2-phenyl-3-prop-2-enyl-1-pyridinyl) trifluoromethanesulfonate |
| SMILES | C=CCc1c(C)cc(=O)n(OS(=O)(=O)C(F)(F)F)c1-c1ccccc1 |
| InChI | InChI=1S/C16H14F3NO4S/c1-3-7-13-11(2)10-14(21)20(24-25(22,23)16(17,18)19)15(13)12-8-5-4-6-9-12/h3-6,8-10H,1,7H2,2H3 |
| InChIKey | DVXWNKLJPLJFLJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|