C20H21FO5S — CID 23218727
(Z)-2-(3-fluorophenyl)-4-methoxy-4-methyl-3-(4-methylsulfonylphenyl)pent-2-enoic acid (PubChem CID 23218727) has the molecular formula C20H21FO5S and a molecular weight of 392.45 g/mol. Its IUPAC name is (Z)-2-(3-fluorophenyl)-4-methoxy-4-methyl-3-(4-methylsulfonylphenyl)pent-2-enoic acid.
| Compound Name | (Z)-2-(3-fluorophenyl)-4-methoxy-4-methyl-3-(4-methylsulfonylphenyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 23218727 |
| Molecular Formula | C20H21FO5S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (Z)-2-(3-fluorophenyl)-4-methoxy-4-methyl-3-(4-methylsulfonylphenyl)pent-2-enoic acid |
| SMILES | COC(C)(C)/C(=C(\C(=O)O)c1cccc(F)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21FO5S/c1-20(2,26-3)18(13-8-10-16(11-9-13)27(4,24)25)17(19(22)23)14-6-5-7-15(21)12-14/h5-12H,1-4H3,(H,22,23)/b18-17- |
| InChIKey | JMHDNYXCSUUOOR-ZCXUNETKSA-N |
| XLogP | 3.65 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|