About 1-iodobiphenylene
1-iodobiphenylene (PubChem CID 23220849) has the molecular formula C12H7I
and a molecular weight of 278.09 g/mol. Its IUPAC name is 1-iodobiphenylene.
Molecular Properties
| Compound Name | 1-iodobiphenylene |
| PubChem CID | 23220849 |
| Molecular Formula | C12H7I |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | 1-iodobiphenylene |
| SMILES | Ic1cccc2c1-c1ccccc1-2 |
| InChI | InChI=1S/C12H7I/c13-11-7-3-6-10-8-4-1-2-5-9(8)12(10)11/h1-7H |
| InChIKey | REXHAHDDKNCVAX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodobiphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodobiphenylene?
The IUPAC name of 1-iodobiphenylene (CID 23220849) is 1-iodobiphenylene.
What is the SMILES notation for 1-iodobiphenylene?
The canonical SMILES for 1-iodobiphenylene is Ic1cccc2c1-c1ccccc1-2.
What is the InChIKey of 1-iodobiphenylene?
The InChIKey is REXHAHDDKNCVAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7I/c13-11-7-3-6-10-8-4-1-2-5-9(8)12(10)11/h1-7H.
What are the key properties of 1-iodobiphenylene?
1-iodobiphenylene has a molecular weight of 278.09 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodobiphenylene is sourced from PubChem (CID 23220849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).